C21H19BrClN3O5S2 — CID 3435467
2-[(4-bromophenyl)sulfonylamino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]benzamide (PubChem CID 3435467) has the molecular formula C21H19BrClN3O5S2 and a molecular weight of 572.89 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3435467 |
| Molecular Formula | C21H19BrClN3O5S2 |
| Molecular Weight | 572.89 g/mol |
| Exact Mass | 570.96 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-N-[4-chloro-3-(dimethylsulfamoyl)phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)c2ccccc2NS(=O)(=O)c2ccc(Br)cc2)ccc1Cl |
| InChI | InChI=1S/C21H19BrClN3O5S2/c1-26(2)33(30,31)20-13-15(9-12-18(20)23)24-21(27)17-5-3-4-6-19(17)25-32(28,29)16-10-7-14(22)8-11-16/h3-13,25H,1-2H3,(H,24,27) |
| InChIKey | OEHYUGAXPVWXNK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.89 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |