C13H16ClN3O3 — CID 34359471
5-chloro-2,4-dimethoxy-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline (PubChem CID 34359471) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 5-chloro-2,4-dimethoxy-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline.
| Compound Name | 5-chloro-2,4-dimethoxy-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 34359471 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-chloro-2,4-dimethoxy-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline |
| SMILES | COc1cc(OC)c(N[C@@H](C)c2nc(C)no2)cc1Cl |
| InChI | InChI=1S/C13H16ClN3O3/c1-7(13-16-8(2)17-20-13)15-10-5-9(14)11(18-3)6-12(10)19-4/h5-7,15H,1-4H3/t7-/m0/s1 |
| InChIKey | LONYCBRFVDVGBD-ZETCQYMHSA-N |
| XLogP | 3.22 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|