About (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid
(1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid (PubChem CID 34364287) has the molecular formula C13H12Cl2O2
and a molecular weight of 271.14 g/mol. Its IUPAC name is (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 34364287 |
| Molecular Formula | C13H12Cl2O2 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CC=CC[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2O2/c14-8-5-6-10(12(15)7-8)9-3-1-2-4-11(9)13(16)17/h1-2,5-7,9,11H,3-4H2,(H,16,17)/t9-,11+/m1/s1 |
| InChIKey | VXWWCWPRSKSEKG-KOLCDFICSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid?
The IUPAC name of (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid (CID 34364287) is (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid is O=C(O)[C@H]1CC=CC[C@@H]1c1ccc(Cl)cc1Cl.
What is the InChIKey of (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid?
The InChIKey is VXWWCWPRSKSEKG-KOLCDFICSA-N. The full InChI is InChI=1S/C13H12Cl2O2/c14-8-5-6-10(12(15)7-8)9-3-1-2-4-11(9)13(16)17/h1-2,5-7,9,11H,3-4H2,(H,16,17)/t9-,11+/m1/s1.
What are the key properties of (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid?
(1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid has a molecular weight of 271.14 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6S)-6-(2,4-dichlorophenyl)cyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 34364287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).