About 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole
2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole (PubChem CID 3436588) has the molecular formula C15H15N3OS
and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole |
| PubChem CID | 3436588 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole |
| SMILES | C=CCSc1nnc(Cc2c(C)[nH]c3ccccc23)o1 |
| InChI | InChI=1S/C15H15N3OS/c1-3-8-20-15-18-17-14(19-15)9-12-10(2)16-13-7-5-4-6-11(12)13/h3-7,16H,1,8-9H2,2H3 |
| InChIKey | OOXSVVLDVANMSX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole?
The IUPAC name of 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole (CID 3436588) is 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole.
What is the SMILES notation for 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole?
The canonical SMILES for 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole is C=CCSc1nnc(Cc2c(C)[nH]c3ccccc23)o1.
What is the InChIKey of 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole?
The InChIKey is OOXSVVLDVANMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3OS/c1-3-8-20-15-18-17-14(19-15)9-12-10(2)16-13-7-5-4-6-11(12)13/h3-7,16H,1,8-9H2,2H3.
What are the key properties of 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole?
2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole has a molecular weight of 285.37 g/mol, XLogP of 3.73, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-1H-indol-3-yl)methyl]-5-prop-2-enylsulfanyl-1,3,4-oxadiazole is sourced from PubChem (CID 3436588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).