C15H17Cl3N2O4S2 — CID 3436697
3,4,5-trimethoxy-N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]benzamide (PubChem CID 3436697) has the molecular formula C15H17Cl3N2O4S2 and a molecular weight of 459.80 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 3436697 |
| Molecular Formula | C15H17Cl3N2O4S2 |
| Molecular Weight | 459.80 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2,2,2-trichloro-1-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)ethyl]benzamide |
| SMILES | COc1cc(C(=O)NC(SC2=NCCS2)C(Cl)(Cl)Cl)cc(OC)c1OC |
| InChI | InChI=1S/C15H17Cl3N2O4S2/c1-22-9-6-8(7-10(23-2)11(9)24-3)12(21)20-13(15(16,17)18)26-14-19-4-5-25-14/h6-7,13H,4-5H2,1-3H3,(H,20,21) |
| InChIKey | GARUZHOZSQBLCS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|