About [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate (PubChem CID 3436968) has the molecular formula C24H19Cl2NO4
and a molecular weight of 456.33 g/mol. Its IUPAC name is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate.
Molecular Properties
| Compound Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate |
| PubChem CID | 3436968 |
| Molecular Formula | C24H19Cl2NO4 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1ccccc1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19Cl2NO4/c25-18-11-10-16(21(26)14-18)12-13-27-22(28)15-31-24(30)20-9-5-4-8-19(20)23(29)17-6-2-1-3-7-17/h1-11,14H,12-13,15H2,(H,27,28) |
| InChIKey | GJIWXFBZSPXSFM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate?
The IUPAC name of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate (CID 3436968) is [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate.
What is the SMILES notation for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate?
The canonical SMILES for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate is O=C(COC(=O)c1ccccc1C(=O)c1ccccc1)NCCc1ccc(Cl)cc1Cl.
What is the InChIKey of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate?
The InChIKey is GJIWXFBZSPXSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19Cl2NO4/c25-18-11-10-16(21(26)14-18)12-13-27-22(28)15-31-24(30)20-9-5-4-8-19(20)23(29)17-6-2-1-3-7-17/h1-11,14H,12-13,15H2,(H,27,28).
What are the key properties of [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate?
[2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate has a molecular weight of 456.33 g/mol, XLogP of 4.74, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2,4-dichlorophenyl)ethylamino]-2-oxoethyl] 2-benzoylbenzoate is sourced from PubChem (CID 3436968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).