About 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one
2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one (PubChem CID 3437115) has the molecular formula C24H31NO
and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one.
Molecular Properties
| Compound Name | 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one |
| PubChem CID | 3437115 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one |
| SMILES | CCC(CC)C(=O)N1c2ccccc2C(C)(c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C24H31NO/c1-6-18(7-2)22(26)25-21-16-12-11-15-20(21)24(5,17-23(25,3)4)19-13-9-8-10-14-19/h8-16,18H,6-7,17H2,1-5H3 |
| InChIKey | VYBFFTOERBODNM-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one?
The IUPAC name of 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one (CID 3437115) is 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one.
What is the SMILES notation for 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one?
The canonical SMILES for 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one is CCC(CC)C(=O)N1c2ccccc2C(C)(c2ccccc2)CC1(C)C.
What is the InChIKey of 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one?
The InChIKey is VYBFFTOERBODNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31NO/c1-6-18(7-2)22(26)25-21-16-12-11-15-20(21)24(5,17-23(25,3)4)19-13-9-8-10-14-19/h8-16,18H,6-7,17H2,1-5H3.
What are the key properties of 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one?
2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one has a molecular weight of 349.52 g/mol, XLogP of 5.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)butan-1-one is sourced from PubChem (CID 3437115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).