About 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate
4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate (PubChem CID 3437286) has the molecular formula C10H10O5-2
and a molecular weight of 210.18 g/mol. Its IUPAC name is 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate |
| PubChem CID | 3437286 |
| Molecular Formula | C10H10O5-2 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate |
| SMILES | CCC([O-])=C1C(=O)CC(C(=O)[O-])CC1=O |
| InChI | InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,11H,2-4H2,1H3,(H,14,15)/p-2/b9-6- |
| InChIKey | HLVQZEMFVYGIGH-TWGQIWQCSA-L |
| XLogP | -1.69 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
The IUPAC name of 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate (CID 3437286) is 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate.
What is the SMILES notation for 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
The canonical SMILES for 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate is CCC([O-])=C1C(=O)CC(C(=O)[O-])CC1=O.
What is the InChIKey of 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
The InChIKey is HLVQZEMFVYGIGH-TWGQIWQCSA-L. The full InChI is InChI=1S/C10H12O5/c1-2-6(11)9-7(12)3-5(10(14)15)4-8(9)13/h5,11H,2-4H2,1H3,(H,14,15)/p-2/b9-6-.
What are the key properties of 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate?
4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate has a molecular weight of 210.18 g/mol, XLogP of -1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate is sourced from PubChem (CID 3437286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).