C26H18O4 — CID 3437445
4,6-dimethyl-3,7-diphenylpyrano[3,2-g]chromene-2,8-dione (PubChem CID 3437445) has the molecular formula C26H18O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4,6-dimethyl-3,7-diphenylpyrano[3,2-g]chromene-2,8-dione.
| Compound Name | 4,6-dimethyl-3,7-diphenylpyrano[3,2-g]chromene-2,8-dione |
|---|---|
| PubChem CID | 3437445 |
| Molecular Formula | C26H18O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4,6-dimethyl-3,7-diphenylpyrano[3,2-g]chromene-2,8-dione |
| SMILES | Cc1c(-c2ccccc2)c(=O)oc2cc3oc(=O)c(-c4ccccc4)c(C)c3cc12 |
| InChI | InChI=1S/C26H18O4/c1-15-19-13-20-16(2)24(18-11-7-4-8-12-18)26(28)30-22(20)14-21(19)29-25(27)23(15)17-9-5-3-6-10-17/h3-14H,1-2H3 |
| InChIKey | RZOSHCSCCMQKIM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|