C27H21FN2O6S — CID 3437954
5-(2,5-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 3437954) has the molecular formula C27H21FN2O6S and a molecular weight of 520.54 g/mol. Its IUPAC name is 5-(2,5-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | 5-(2,5-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3437954 |
| Molecular Formula | C27H21FN2O6S |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 5-(2,5-dimethoxyphenyl)-4-[(4-fluorophenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(OC)c(C2C(=C(O)c3ccc(F)cc3)C(=O)C(=O)N2c2nc3ccc(OC)cc3s2)c1 |
| InChI | InChI=1S/C27H21FN2O6S/c1-34-16-9-11-20(36-3)18(12-16)23-22(24(31)14-4-6-15(28)7-5-14)25(32)26(33)30(23)27-29-19-10-8-17(35-2)13-21(19)37-27/h4-13,23,31H,1-3H3 |
| InChIKey | HFQSXWBNDKCOLU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|