About N-butyl-1,1-dioxothiolane-3-sulfonamide
N-butyl-1,1-dioxothiolane-3-sulfonamide (PubChem CID 3439064) has the molecular formula C8H17NO4S2
and a molecular weight of 255.36 g/mol. Its IUPAC name is N-butyl-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-butyl-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 3439064 |
| Molecular Formula | C8H17NO4S2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | N-butyl-1,1-dioxothiolane-3-sulfonamide |
| SMILES | CCCCNS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H17NO4S2/c1-2-3-5-9-15(12,13)8-4-6-14(10,11)7-8/h8-9H,2-7H2,1H3 |
| InChIKey | CKRIHCSJQFWBEG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of N-butyl-1,1-dioxothiolane-3-sulfonamide (CID 3439064) is N-butyl-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for N-butyl-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for N-butyl-1,1-dioxothiolane-3-sulfonamide is CCCCNS(=O)(=O)C1CCS(=O)(=O)C1.
What is the InChIKey of N-butyl-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is CKRIHCSJQFWBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4S2/c1-2-3-5-9-15(12,13)8-4-6-14(10,11)7-8/h8-9H,2-7H2,1H3.
What are the key properties of N-butyl-1,1-dioxothiolane-3-sulfonamide?
N-butyl-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 255.36 g/mol, XLogP of -0.11, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 3439064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).