C15H26N2O2S — CID 34392899
(3S,7aS)-7a-methyl-N-[(2S)-5-methylhexan-2-yl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 34392899) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is (3S,7aS)-7a-methyl-N-[(2S)-5-methylhexan-2-yl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aS)-7a-methyl-N-[(2S)-5-methylhexan-2-yl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 34392899 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (3S,7aS)-7a-methyl-N-[(2S)-5-methylhexan-2-yl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC(C)CC[C@H](C)NC(=O)[C@H]1CS[C@@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C15H26N2O2S/c1-10(2)5-6-11(3)16-14(19)12-9-20-15(4)8-7-13(18)17(12)15/h10-12H,5-9H2,1-4H3,(H,16,19)/t11-,12+,15-/m0/s1 |
| InChIKey | UQCZZZWAFGLXGJ-ZOWXZIJZSA-N |
| XLogP | 2.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |