About 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one
1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one (PubChem CID 3439803) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one.
Molecular Properties
| Compound Name | 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one |
| PubChem CID | 3439803 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc3[nH]cnc3cc21 |
| InChI | InChI=1S/C10H10N4O/c1-13-8-3-6-7(12-5-11-6)4-9(8)14(2)10(13)15/h3-5H,1-2H3,(H,11,12) |
| InChIKey | QUEXVBNPLGCNGI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one?
The IUPAC name of 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one (CID 3439803) is 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one.
What is the SMILES notation for 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one?
The canonical SMILES for 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one is Cn1c(=O)n(C)c2cc3[nH]cnc3cc21.
What is the InChIKey of 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one?
The InChIKey is QUEXVBNPLGCNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c1-13-8-3-6-7(12-5-11-6)4-9(8)14(2)10(13)15/h3-5H,1-2H3,(H,11,12).
What are the key properties of 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one?
1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one has a molecular weight of 202.22 g/mol, XLogP of 0.75, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5H-imidazo[4,5-f]benzimidazol-2-one is sourced from PubChem (CID 3439803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).