About [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone
[4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 3440389) has the molecular formula C14H16Br2N2O3
and a molecular weight of 420.10 g/mol. Its IUPAC name is [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone.
Molecular Properties
| Compound Name | [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
| PubChem CID | 3440389 |
| Molecular Formula | C14H16Br2N2O3 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CC1(C(=O)N2CCN(C(=O)c3ccco3)CC2)CC1(Br)Br |
| InChI | InChI=1S/C14H16Br2N2O3/c1-13(9-14(13,15)16)12(20)18-6-4-17(5-7-18)11(19)10-3-2-8-21-10/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | PJNOOQVLZFXUSJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone?
The IUPAC name of [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone (CID 3440389) is [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone.
What is the SMILES notation for [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone?
The canonical SMILES for [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone is CC1(C(=O)N2CCN(C(=O)c3ccco3)CC2)CC1(Br)Br.
What is the InChIKey of [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone?
The InChIKey is PJNOOQVLZFXUSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Br2N2O3/c1-13(9-14(13,15)16)12(20)18-6-4-17(5-7-18)11(19)10-3-2-8-21-10/h2-3,8H,4-7,9H2,1H3.
What are the key properties of [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone?
[4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone has a molecular weight of 420.10 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dibromo-1-methylcyclopropanecarbonyl)piperazin-1-yl]-(furan-2-yl)methanone is sourced from PubChem (CID 3440389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).