About 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile
2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile (PubChem CID 3442118) has the molecular formula C11H10N2OS
and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile |
| PubChem CID | 3442118 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile |
| SMILES | CSc1nc2c(cc1C#N)C(=O)CCC2 |
| InChI | InChI=1S/C11H10N2OS/c1-15-11-7(6-12)5-8-9(13-11)3-2-4-10(8)14/h5H,2-4H2,1H3 |
| InChIKey | XINVZSLYRJDJCC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile?
The IUPAC name of 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile (CID 3442118) is 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile.
What is the SMILES notation for 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile?
The canonical SMILES for 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile is CSc1nc2c(cc1C#N)C(=O)CCC2.
What is the InChIKey of 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile?
The InChIKey is XINVZSLYRJDJCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2OS/c1-15-11-7(6-12)5-8-9(13-11)3-2-4-10(8)14/h5H,2-4H2,1H3.
What are the key properties of 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile?
2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile has a molecular weight of 218.28 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-5-oxo-7,8-dihydro-6H-quinoline-3-carbonitrile is sourced from PubChem (CID 3442118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).