C14H8F5N — CID 3442452
N-benzyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine (PubChem CID 3442452) has the molecular formula C14H8F5N and a molecular weight of 285.21 g/mol. Its IUPAC name is N-benzyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine.
| Compound Name | N-benzyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
|---|---|
| PubChem CID | 3442452 |
| Molecular Formula | C14H8F5N |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | N-benzyl-1-(2,3,4,5,6-pentafluorophenyl)methanimine |
| SMILES | Fc1c(F)c(F)c(/C=N/Cc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C14H8F5N/c15-10-9(11(16)13(18)14(19)12(10)17)7-20-6-8-4-2-1-3-5-8/h1-5,7H,6H2/b20-7+ |
| InChIKey | NVSXMIARPOKNGA-IFRROFPPSA-N |
| XLogP | 4.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|