About (propan-2-ylamino) 4-chlorobenzoate
(propan-2-ylamino) 4-chlorobenzoate (PubChem CID 3442504) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is (propan-2-ylamino) 4-chlorobenzoate.
Molecular Properties
| Compound Name | (propan-2-ylamino) 4-chlorobenzoate |
| PubChem CID | 3442504 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (propan-2-ylamino) 4-chlorobenzoate |
| SMILES | CC(C)NOC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO2/c1-7(2)12-14-10(13)8-3-5-9(11)6-4-8/h3-7,12H,1-2H3 |
| InChIKey | SKJBVPVHTQMCKK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylamino) 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylamino) 4-chlorobenzoate?
The IUPAC name of (propan-2-ylamino) 4-chlorobenzoate (CID 3442504) is (propan-2-ylamino) 4-chlorobenzoate.
What is the SMILES notation for (propan-2-ylamino) 4-chlorobenzoate?
The canonical SMILES for (propan-2-ylamino) 4-chlorobenzoate is CC(C)NOC(=O)c1ccc(Cl)cc1.
What is the InChIKey of (propan-2-ylamino) 4-chlorobenzoate?
The InChIKey is SKJBVPVHTQMCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO2/c1-7(2)12-14-10(13)8-3-5-9(11)6-4-8/h3-7,12H,1-2H3.
What are the key properties of (propan-2-ylamino) 4-chlorobenzoate?
(propan-2-ylamino) 4-chlorobenzoate has a molecular weight of 213.66 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylamino) 4-chlorobenzoate is sourced from PubChem (CID 3442504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).