About 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid
2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid (PubChem CID 34427695) has the molecular formula C21H17N3O2S2
and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid.
Molecular Properties
| Compound Name | 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid |
| PubChem CID | 34427695 |
| Molecular Formula | C21H17N3O2S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid |
| SMILES | O=C(O)CS/C(=C\c1cnn(Cc2ccccc2)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H17N3O2S2/c25-20(26)14-27-19(21-23-17-8-4-5-9-18(17)28-21)10-16-11-22-24(13-16)12-15-6-2-1-3-7-15/h1-11,13H,12,14H2,(H,25,26)/b19-10- |
| InChIKey | JRHYTLUMIZYUMC-GRSHGNNSSA-N |
| XLogP | 4.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid?
The IUPAC name of 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid (CID 34427695) is 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid.
What is the SMILES notation for 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid?
The canonical SMILES for 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid is O=C(O)CS/C(=C\c1cnn(Cc2ccccc2)c1)c1nc2ccccc2s1.
What is the InChIKey of 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid?
The InChIKey is JRHYTLUMIZYUMC-GRSHGNNSSA-N. The full InChI is InChI=1S/C21H17N3O2S2/c25-20(26)14-27-19(21-23-17-8-4-5-9-18(17)28-21)10-16-11-22-24(13-16)12-15-6-2-1-3-7-15/h1-11,13H,12,14H2,(H,25,26)/b19-10-.
What are the key properties of 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid?
2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid has a molecular weight of 407.52 g/mol, XLogP of 4.86, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-1-(1,3-benzothiazol-2-yl)-2-(1-benzylpyrazol-4-yl)ethenyl]sulfanylacetic acid is sourced from PubChem (CID 34427695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).