C30H19BrF3N3O3S — CID 3444092
9-bromo-2-phenyl-5'-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 3444092) has the molecular formula C30H19BrF3N3O3S and a molecular weight of 638.47 g/mol. Its IUPAC name is 9-bromo-2-phenyl-5'-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | 9-bromo-2-phenyl-5'-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 3444092 |
| Molecular Formula | C30H19BrF3N3O3S |
| Molecular Weight | 638.47 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | 9-bromo-2-phenyl-5'-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylidene]spiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1NC2(Oc3ccc(Br)cc3C3CC(c4ccccc4)=NN32)C(=Cc2ccc(-c3cccc(C(F)(F)F)c3)o2)S1 |
| InChI | InChI=1S/C30H19BrF3N3O3S/c31-20-9-11-26-22(14-20)24-16-23(17-5-2-1-3-6-17)36-37(24)30(40-26)27(41-28(38)35-30)15-21-10-12-25(39-21)18-7-4-8-19(13-18)29(32,33)34/h1-15,24H,16H2,(H,35,38) |
| InChIKey | VJJMFMVWBGVDSK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.47 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|