C20H11Cl2N3O4 — CID 3444299
2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 3444299) has the molecular formula C20H11Cl2N3O4 and a molecular weight of 428.23 g/mol. Its IUPAC name is 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3444299 |
| Molecular Formula | C20H11Cl2N3O4 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2cccc(Cl)c2Cl)o1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H11Cl2N3O4/c21-17-6-2-5-16(19(17)22)18-8-7-15(29-18)9-12(11-23)20(26)24-13-3-1-4-14(10-13)25(27)28/h1-10H,(H,24,26) |
| InChIKey | QPNNKAXAZGGRNH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 109.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|