C17H11Cl2NO4S2 — CID 3444503
3-[5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 3444503) has the molecular formula C17H11Cl2NO4S2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 3-[5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 3444503 |
| Molecular Formula | C17H11Cl2NO4S2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | 3-[5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C(=Cc2ccc(-c3c(Cl)cccc3Cl)o2)SC1=S |
| InChI | InChI=1S/C17H11Cl2NO4S2/c18-10-2-1-3-11(19)15(10)12-5-4-9(24-12)8-13-16(23)20(17(25)26-13)7-6-14(21)22/h1-5,8H,6-7H2,(H,21,22) |
| InChIKey | MRXLZHSIWVGLKV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|