About 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol
2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol (PubChem CID 3445006) has the molecular formula C15H12ClN5O
and a molecular weight of 313.75 g/mol. Its IUPAC name is 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol.
Molecular Properties
| Compound Name | 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol |
| PubChem CID | 3445006 |
| Molecular Formula | C15H12ClN5O |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol |
| SMILES | Nc1nc(Nc2ccccc2)nc(-c2cc(Cl)ccc2O)n1 |
| InChI | InChI=1S/C15H12ClN5O/c16-9-6-7-12(22)11(8-9)13-19-14(17)21-15(20-13)18-10-4-2-1-3-5-10/h1-8,22H,(H3,17,18,19,20,21) |
| InChIKey | GLZDHSRHLCFCED-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol?
The IUPAC name of 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol (CID 3445006) is 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol.
What is the SMILES notation for 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol?
The canonical SMILES for 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol is Nc1nc(Nc2ccccc2)nc(-c2cc(Cl)ccc2O)n1.
What is the InChIKey of 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol?
The InChIKey is GLZDHSRHLCFCED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN5O/c16-9-6-7-12(22)11(8-9)13-19-14(17)21-15(20-13)18-10-4-2-1-3-5-10/h1-8,22H,(H3,17,18,19,20,21).
What are the key properties of 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol?
2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol has a molecular weight of 313.75 g/mol, XLogP of 3.22, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-6-anilino-1,3,5-triazin-2-yl)-4-chlorophenol is sourced from PubChem (CID 3445006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).