C21H24F2N4O4S — CID 3447933
N-(2,5-difluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]acetamide (PubChem CID 3447933) has the molecular formula C21H24F2N4O4S and a molecular weight of 466.51 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]acetamide.
| Compound Name | N-(2,5-difluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]acetamide |
|---|---|
| PubChem CID | 3447933 |
| Molecular Formula | C21H24F2N4O4S |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-(2,5-difluorophenyl)-2-[2-[1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]hydrazinyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCC(C(=O)NNCC(=O)Nc3cc(F)ccc3F)C2)cc1 |
| InChI | InChI=1S/C21H24F2N4O4S/c1-14-4-7-17(8-5-14)32(30,31)27-10-2-3-15(13-27)21(29)26-24-12-20(28)25-19-11-16(22)6-9-18(19)23/h4-9,11,15,24H,2-3,10,12-13H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | ZFFCKTJQBMDDCR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|