C19H23NO5 — CID 34485199
methyl 5-[[3-(3-methoxyphenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylate (PubChem CID 34485199) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 5-[[3-(3-methoxyphenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[3-(3-methoxyphenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 34485199 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | methyl 5-[[3-(3-methoxyphenyl)propanoyl-methylamino]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(CN(C)C(=O)CCc2cccc(OC)c2)oc1C |
| InChI | InChI=1S/C19H23NO5/c1-13-17(19(22)24-4)11-16(25-13)12-20(2)18(21)9-8-14-6-5-7-15(10-14)23-3/h5-7,10-11H,8-9,12H2,1-4H3 |
| InChIKey | IFXKRRVPLJZYGU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |