C15H13N2O4+ — CID 3449488
4,5-dimethoxy-2-pyridin-1-ium-2-ylisoindole-1,3-dione (PubChem CID 3449488) has the molecular formula C15H13N2O4+ and a molecular weight of 285.28 g/mol. Its IUPAC name is 4,5-dimethoxy-2-pyridin-1-ium-2-ylisoindole-1,3-dione.
| Compound Name | 4,5-dimethoxy-2-pyridin-1-ium-2-ylisoindole-1,3-dione |
|---|---|
| PubChem CID | 3449488 |
| Molecular Formula | C15H13N2O4+ |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4,5-dimethoxy-2-pyridin-1-ium-2-ylisoindole-1,3-dione |
| SMILES | COc1ccc2c(c1OC)C(=O)N(c1cccc[nH+]1)C2=O |
| InChI | InChI=1S/C15H12N2O4/c1-20-10-7-6-9-12(13(10)21-2)15(19)17(14(9)18)11-5-3-4-8-16-11/h3-8H,1-2H3/p+1 |
| InChIKey | XKANEMOUIWOPRG-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 69.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|