About 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate
4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate (PubChem CID 3449593) has the molecular formula C33H27NO2
and a molecular weight of 469.58 g/mol. Its IUPAC name is 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate.
Molecular Properties
| Compound Name | 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate |
| PubChem CID | 3449593 |
| Molecular Formula | C33H27NO2 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate |
| SMILES | Cc1ccc(-c2cc(-c3ccc(C)cc3)[n+](-c3ccc(C(=O)[O-])cc3)c(-c3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C33H27NO2/c1-22-4-10-25(11-5-22)29-20-31(26-12-6-23(2)7-13-26)34(30-18-16-28(17-19-30)33(35)36)32(21-29)27-14-8-24(3)9-15-27/h4-21H,1-3H3 |
| InChIKey | PFMYFSGUORUPOS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate?
The IUPAC name of 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate (CID 3449593) is 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate.
What is the SMILES notation for 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate?
The canonical SMILES for 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate is Cc1ccc(-c2cc(-c3ccc(C)cc3)[n+](-c3ccc(C(=O)[O-])cc3)c(-c3ccc(C)cc3)c2)cc1.
What is the InChIKey of 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate?
The InChIKey is PFMYFSGUORUPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H27NO2/c1-22-4-10-25(11-5-22)29-20-31(26-12-6-23(2)7-13-26)34(30-18-16-28(17-19-30)33(35)36)32(21-29)27-14-8-24(3)9-15-27/h4-21H,1-3H3.
What are the key properties of 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate?
4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate has a molecular weight of 469.58 g/mol, XLogP of 6.25, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,4,6-tris(4-methylphenyl)pyridin-1-ium-1-yl]benzoate is sourced from PubChem (CID 3449593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).