C28H22N4OS2 — CID 3449599
5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-quinolin-6-ylimino-1,3-thiazolidin-4-one (PubChem CID 3449599) has the molecular formula C28H22N4OS2 and a molecular weight of 494.65 g/mol. Its IUPAC name is 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-quinolin-6-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-quinolin-6-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3449599 |
| Molecular Formula | C28H22N4OS2 |
| Molecular Weight | 494.65 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 5-(3-methyl-1,3-benzothiazol-2-ylidene)-3-(2-phenylethyl)-2-quinolin-6-ylimino-1,3-thiazolidin-4-one |
| SMILES | CN1C(=C2S/C(=N/c3ccc4ncccc4c3)N(CCc3ccccc3)C2=O)Sc2ccccc21 |
| InChI | InChI=1S/C28H22N4OS2/c1-31-23-11-5-6-12-24(23)34-27(31)25-26(33)32(17-15-19-8-3-2-4-9-19)28(35-25)30-21-13-14-22-20(18-21)10-7-16-29-22/h2-14,16,18H,15,17H2,1H3/b27-25?,30-28+ |
| InChIKey | PHOMBXLJRPJHFV-ZZMPWDLGSA-N |
| XLogP | 6.45 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.65 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|