C26H27N4O4+ — CID 3450004
3-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 3450004) has the molecular formula C26H27N4O4+ and a molecular weight of 459.53 g/mol. Its IUPAC name is 3-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 3450004 |
| Molecular Formula | C26H27N4O4+ |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 3-(5-ethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)-4-(3-methylpyridin-1-ium-1-yl)-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | CCc1[nH]n(-c2ccccc2)c(=O)c1C1=C([n+]2cccc(C)c2)C(=O)N(CC2CCCO2)C1=O |
| InChI | InChI=1S/C26H26N4O4/c1-3-20-21(25(32)30(27-20)18-10-5-4-6-11-18)22-23(28-13-7-9-17(2)15-28)26(33)29(24(22)31)16-19-12-8-14-34-19/h4-7,9-11,13,15,19H,3,8,12,14,16H2,1-2H3/p+1 |
| InChIKey | WEFCUNIAWSJXSL-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 88.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|