About 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide
2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide (PubChem CID 3450026) has the molecular formula C10H11N3O2S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide |
| PubChem CID | 3450026 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide |
| SMILES | NNC(=O)CC1Sc2ccccc2NC1=O |
| InChI | InChI=1S/C10H11N3O2S/c11-13-9(14)5-8-10(15)12-6-3-1-2-4-7(6)16-8/h1-4,8H,5,11H2,(H,12,15)(H,13,14) |
| InChIKey | QWRORGHKZBEAOV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide?
The IUPAC name of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide (CID 3450026) is 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide.
What is the SMILES notation for 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide?
The canonical SMILES for 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide is NNC(=O)CC1Sc2ccccc2NC1=O.
What is the InChIKey of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide?
The InChIKey is QWRORGHKZBEAOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S/c11-13-9(14)5-8-10(15)12-6-3-1-2-4-7(6)16-8/h1-4,8H,5,11H2,(H,12,15)(H,13,14).
What are the key properties of 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide?
2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide has a molecular weight of 237.28 g/mol, XLogP of 0.48, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-oxo-4H-1,4-benzothiazin-2-yl)acetohydrazide is sourced from PubChem (CID 3450026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).