C36H42F3NO7S — CID 3450091
N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide (PubChem CID 3450091) has the molecular formula C36H42F3NO7S and a molecular weight of 689.79 g/mol. Its IUPAC name is N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide.
| Compound Name | N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 3450091 |
| Molecular Formula | C36H42F3NO7S |
| Molecular Weight | 689.79 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | N-[[17-(furan-2-carbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-[[4-(trifluoromethoxy)phenyl]methyl]methanesulfonamide |
| SMILES | CC1=CCCC2(C)C(CCC2(O)CN(Cc2ccc(OC(F)(F)F)cc2)S(C)(=O)=O)c2ccc(cc2C(=O)c2ccco2)CC(O)CC1 |
| InChI | InChI=1S/C36H42F3NO7S/c1-24-6-4-17-34(2)31(29-15-11-26(20-27(41)12-8-24)21-30(29)33(42)32-7-5-19-46-32)16-18-35(34,43)23-40(48(3,44)45)22-25-9-13-28(14-10-25)47-36(37,38)39/h5-7,9-11,13-15,19,21,27,31,41,43H,4,8,12,16-18,20,22-23H2,1-3H3 |
| InChIKey | VHJKVUQIFNHUND-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.79 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|