About 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide
3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide (PubChem CID 34502613) has the molecular formula C10H11Cl2NOS
and a molecular weight of 264.18 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide.
Molecular Properties
| Compound Name | 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide |
| PubChem CID | 34502613 |
| Molecular Formula | C10H11Cl2NOS |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide |
| SMILES | NC(=O)CCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H11Cl2NOS/c11-8-2-1-3-9(12)7(8)6-15-5-4-10(13)14/h1-3H,4-6H2,(H2,13,14) |
| InChIKey | IPDAACZTNDAGDQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide?
The IUPAC name of 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide (CID 34502613) is 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide?
The canonical SMILES for 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide is NC(=O)CCSCc1c(Cl)cccc1Cl.
What is the InChIKey of 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide?
The InChIKey is IPDAACZTNDAGDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NOS/c11-8-2-1-3-9(12)7(8)6-15-5-4-10(13)14/h1-3H,4-6H2,(H2,13,14).
What are the key properties of 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide?
3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide has a molecular weight of 264.18 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)methylsulfanyl]propanamide is sourced from PubChem (CID 34502613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).