About 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate
2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 3450410) has the molecular formula C10H8NO3S-
and a molecular weight of 222.25 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| PubChem CID | 3450410 |
| Molecular Formula | C10H8NO3S- |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | O=C([O-])C1CSC(c2ccccc2O)=N1 |
| InChI | InChI=1S/C10H9NO3S/c12-8-4-2-1-3-6(8)9-11-7(5-15-9)10(13)14/h1-4,7,12H,5H2,(H,13,14)/p-1 |
| InChIKey | CECDPVOEINSAQG-UHFFFAOYSA-M |
| XLogP | 0.00 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The IUPAC name of 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate (CID 3450410) is 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The canonical SMILES for 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate is O=C([O-])C1CSC(c2ccccc2O)=N1.
What is the InChIKey of 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
The InChIKey is CECDPVOEINSAQG-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO3S/c12-8-4-2-1-3-6(8)9-11-7(5-15-9)10(13)14/h1-4,7,12H,5H2,(H,13,14)/p-1.
What are the key properties of 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate?
2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate has a molecular weight of 222.25 g/mol, XLogP of 0.00, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 3450410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).