C10H20O4 — CID 345052
3,6-Dimethoxy-2,2,5,5-tetramethyl-1,4-dioxane (PubChem CID 345052) has the molecular formula C10H20O4 and a molecular weight of 204.26 g/mol. Its IUPAC name is 3,6-dimethoxy-2,2,5,5-tetramethyl-1,4-dioxane.
| Compound Name | 3,6-Dimethoxy-2,2,5,5-tetramethyl-1,4-dioxane |
|---|---|
| PubChem CID | 345052 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3,6-dimethoxy-2,2,5,5-tetramethyl-1,4-dioxane |
| SMILES | CC1(C(OC(C(O1)OC)(C)C)OC)C |
| InChI | InChI=1S/C10H20O4/c1-9(2)7(11-5)14-10(3,4)8(12-6)13-9/h7-8H,1-6H3 |
| InChIKey | SHKMVMDDZRIKBO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 36.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 178 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |