C9H4ClF14NO — CID 3450851
8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-methyloctanamide (PubChem CID 3450851) has the molecular formula C9H4ClF14NO and a molecular weight of 443.56 g/mol. Its IUPAC name is 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-methyloctanamide.
| Compound Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-methyloctanamide |
|---|---|
| PubChem CID | 3450851 |
| Molecular Formula | C9H4ClF14NO |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | 8-chloro-2,2,3,3,4,4,5,5,6,6,7,7,8,8-tetradecafluoro-N-methyloctanamide |
| SMILES | CNC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C9H4ClF14NO/c1-25-2(26)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(10,23)24/h1H3,(H,25,26) |
| InChIKey | KADUCNYVQVKQPM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|