About [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate (PubChem CID 34509541) has the molecular formula C22H18FN3O4S
and a molecular weight of 439.47 g/mol. Its IUPAC name is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate |
| PubChem CID | 34509541 |
| Molecular Formula | C22H18FN3O4S |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate |
| SMILES | COc1ccc2cc(C(=O)OCc3csc(N(C(C)=O)c4ccccc4F)n3)[nH]c2c1 |
| InChI | InChI=1S/C22H18FN3O4S/c1-13(27)26(20-6-4-3-5-17(20)23)22-24-15(12-31-22)11-30-21(28)19-9-14-7-8-16(29-2)10-18(14)25-19/h3-10,12,25H,11H2,1-2H3 |
| InChIKey | XCQMEQZZTSLNKD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate?
The IUPAC name of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate (CID 34509541) is [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate.
What is the SMILES notation for [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate?
The canonical SMILES for [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate is COc1ccc2cc(C(=O)OCc3csc(N(C(C)=O)c4ccccc4F)n3)[nH]c2c1.
What is the InChIKey of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate?
The InChIKey is XCQMEQZZTSLNKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18FN3O4S/c1-13(27)26(20-6-4-3-5-17(20)23)22-24-15(12-31-22)11-30-21(28)19-9-14-7-8-16(29-2)10-18(14)25-19/h3-10,12,25H,11H2,1-2H3.
What are the key properties of [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate?
[2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate has a molecular weight of 439.47 g/mol, XLogP of 4.81, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-acetyl-2-fluoroanilino)-1,3-thiazol-4-yl]methyl 6-methoxy-1H-indole-2-carboxylate is sourced from PubChem (CID 34509541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).