C25H19NO4S2 — CID 3451264
methyl 4-[4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate (PubChem CID 3451264) has the molecular formula C25H19NO4S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is methyl 4-[4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | methyl 4-[4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 3451264 |
| Molecular Formula | C25H19NO4S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | methyl 4-[4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C(=Cc3ccc(OCc4ccccc4)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C25H19NO4S2/c1-29-24(28)19-9-11-20(12-10-19)26-23(27)22(32-25(26)31)15-17-7-13-21(14-8-17)30-16-18-5-3-2-4-6-18/h2-15H,16H2,1H3 |
| InChIKey | FUCFSYKGXNWWFR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|