C33H27Cl2F5N2O6 — CID 3452011
6a,9a-dichloro-2-cyclohexyl-6-(2-hydroxy-5-methoxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3452011) has the molecular formula C33H27Cl2F5N2O6 and a molecular weight of 713.48 g/mol. Its IUPAC name is 6a,9a-dichloro-2-cyclohexyl-6-(2-hydroxy-5-methoxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-cyclohexyl-6-(2-hydroxy-5-methoxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3452011 |
| Molecular Formula | C33H27Cl2F5N2O6 |
| Molecular Weight | 713.48 g/mol |
| Exact Mass | 712.12 |
| IUPAC Name | 6a,9a-dichloro-2-cyclohexyl-6-(2-hydroxy-5-methoxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(O)c(C2C3=CCC4C(=O)N(C5CCCCC5)C(=O)C4C3CC3(Cl)C(=O)N(c4c(F)c(F)c(F)c(F)c4F)C(=O)C23Cl)c1 |
| InChI | InChI=1S/C33H27Cl2F5N2O6/c1-48-14-7-10-19(43)17(11-14)21-15-8-9-16-20(29(45)41(28(16)44)13-5-3-2-4-6-13)18(15)12-32(34)30(46)42(31(47)33(21,32)35)27-25(39)23(37)22(36)24(38)26(27)40/h7-8,10-11,13,16,18,20-21,43H,2-6,9,12H2,1H3 |
| InChIKey | RSPGHPNORHHWNS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|