About [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate (PubChem CID 3453266) has the molecular formula C19H27NO3
and a molecular weight of 317.43 g/mol. Its IUPAC name is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate.
Molecular Properties
| Compound Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate |
| PubChem CID | 3453266 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCC(=O)N1C(C)CCCC1C)c1ccccc1 |
| InChI | InChI=1S/C19H27NO3/c1-4-17(16-11-6-5-7-12-16)19(22)23-13-18(21)20-14(2)9-8-10-15(20)3/h5-7,11-12,14-15,17H,4,8-10,13H2,1-3H3 |
| InChIKey | HSFSMAMJZRQHBZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate?
The IUPAC name of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate (CID 3453266) is [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate.
What is the SMILES notation for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate?
The canonical SMILES for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate is CCC(C(=O)OCC(=O)N1C(C)CCCC1C)c1ccccc1.
What is the InChIKey of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate?
The InChIKey is HSFSMAMJZRQHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO3/c1-4-17(16-11-6-5-7-12-16)19(22)23-13-18(21)20-14(2)9-8-10-15(20)3/h5-7,11-12,14-15,17H,4,8-10,13H2,1-3H3.
What are the key properties of [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate?
[2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate has a molecular weight of 317.43 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylpiperidin-1-yl)-2-oxoethyl] 2-phenylbutanoate is sourced from PubChem (CID 3453266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).