About 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one
3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one (PubChem CID 3454035) has the molecular formula C14H11F2NOS2
and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one |
| PubChem CID | 3454035 |
| Molecular Formula | C14H11F2NOS2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccsc2)N1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H11F2NOS2/c15-11-3-9(4-12(16)5-11)6-17-13(18)8-20-14(17)10-1-2-19-7-10/h1-5,7,14H,6,8H2 |
| InChIKey | YTYSGYSLSNHECF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one?
The IUPAC name of 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one (CID 3454035) is 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one is O=C1CSC(c2ccsc2)N1Cc1cc(F)cc(F)c1.
What is the InChIKey of 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one?
The InChIKey is YTYSGYSLSNHECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NOS2/c15-11-3-9(4-12(16)5-11)6-17-13(18)8-20-14(17)10-1-2-19-7-10/h1-5,7,14H,6,8H2.
What are the key properties of 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one?
3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one has a molecular weight of 311.38 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-difluorophenyl)methyl]-2-thiophen-3-yl-1,3-thiazolidin-4-one is sourced from PubChem (CID 3454035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).