C14H8F6N2OS — CID 3454042
1,1,1,3,3,3-hexafluoro-2-(6-phenylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol (PubChem CID 3454042) has the molecular formula C14H8F6N2OS and a molecular weight of 366.29 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(6-phenylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(6-phenylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 3454042 |
| Molecular Formula | C14H8F6N2OS |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(6-phenylimidazo[2,1-b][1,3]thiazol-2-yl)propan-2-ol |
| SMILES | OC(c1cn2cc(-c3ccccc3)nc2s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H8F6N2OS/c15-13(16,17)12(23,14(18,19)20)10-7-22-6-9(21-11(22)24-10)8-4-2-1-3-5-8/h1-7,23H |
| InChIKey | UZQFDGDFJGTFCF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |