About 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile
1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile (PubChem CID 3454191) has the molecular formula C11H7N5O2
and a molecular weight of 241.21 g/mol. Its IUPAC name is 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile |
| PubChem CID | 3454191 |
| Molecular Formula | C11H7N5O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccco2)c(C#N)c(=O)n(N)c1N |
| InChI | InChI=1S/C11H7N5O2/c12-4-6-9(8-2-1-3-18-8)7(5-13)11(17)16(15)10(6)14/h1-3H,14-15H2 |
| InChIKey | CTZLADLIVLTPBX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile?
The IUPAC name of 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile (CID 3454191) is 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile.
What is the SMILES notation for 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile?
The canonical SMILES for 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile is N#Cc1c(-c2ccco2)c(C#N)c(=O)n(N)c1N.
What is the InChIKey of 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile?
The InChIKey is CTZLADLIVLTPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O2/c12-4-6-9(8-2-1-3-18-8)7(5-13)11(17)16(15)10(6)14/h1-3H,14-15H2.
What are the key properties of 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile?
1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile has a molecular weight of 241.21 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diamino-4-(furan-2-yl)-6-oxopyridine-3,5-dicarbonitrile is sourced from PubChem (CID 3454191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).