About 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide
4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide (PubChem CID 3454612) has the molecular formula C17H11N3O4S
and a molecular weight of 353.36 g/mol. Its IUPAC name is 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| PubChem CID | 3454612 |
| Molecular Formula | C17H11N3O4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H11N3O4S/c21-15(11-4-2-1-3-5-11)12-6-8-13(9-7-12)16(22)19-17-18-10-14(25-17)20(23)24/h1-10H,(H,18,19,22) |
| InChIKey | IJSAUCKIWJIKIK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide?
The IUPAC name of 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide (CID 3454612) is 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide is O=C(Nc1ncc([N+](=O)[O-])s1)c1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide?
The InChIKey is IJSAUCKIWJIKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N3O4S/c21-15(11-4-2-1-3-5-11)12-6-8-13(9-7-12)16(22)19-17-18-10-14(25-17)20(23)24/h1-10H,(H,18,19,22).
What are the key properties of 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide?
4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide has a molecular weight of 353.36 g/mol, XLogP of 3.53, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzoyl-N-(5-nitro-1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 3454612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).