About N-propan-2-yloctanamide
N-propan-2-yloctanamide (PubChem CID 3454942) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is N-propan-2-yloctanamide.
Molecular Properties
| Compound Name | N-propan-2-yloctanamide |
| PubChem CID | 3454942 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | N-propan-2-yloctanamide |
| SMILES | CCCCCCCC(=O)NC(C)C |
| InChI | InChI=1S/C11H23NO/c1-4-5-6-7-8-9-11(13)12-10(2)3/h10H,4-9H2,1-3H3,(H,12,13) |
| InChIKey | VEELBAIKCLTEML-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yloctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yloctanamide?
The IUPAC name of N-propan-2-yloctanamide (CID 3454942) is N-propan-2-yloctanamide.
What is the SMILES notation for N-propan-2-yloctanamide?
The canonical SMILES for N-propan-2-yloctanamide is CCCCCCCC(=O)NC(C)C.
What is the InChIKey of N-propan-2-yloctanamide?
The InChIKey is VEELBAIKCLTEML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-4-5-6-7-8-9-11(13)12-10(2)3/h10H,4-9H2,1-3H3,(H,12,13).
What are the key properties of N-propan-2-yloctanamide?
N-propan-2-yloctanamide has a molecular weight of 185.31 g/mol, XLogP of 2.87, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yloctanamide is sourced from PubChem (CID 3454942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).