C26H30N4O7S — CID 3455219
4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 3455219) has the molecular formula C26H30N4O7S and a molecular weight of 542.61 g/mol. Its IUPAC name is 4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3455219 |
| Molecular Formula | C26H30N4O7S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 4-[hydroxy-(4-morpholin-4-ylsulfonylphenyl)methylidene]-1-(2-morpholin-4-ylethyl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCN2CCOCC2)C(c2cccnc2)C1=C(O)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H30N4O7S/c31-24(19-3-5-21(6-4-19)38(34,35)29-12-16-37-17-13-29)22-23(20-2-1-7-27-18-20)30(26(33)25(22)32)9-8-28-10-14-36-15-11-28/h1-7,18,23,31H,8-17H2 |
| InChIKey | MTDHOHXVORQAIT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|