C25H27FN6O — CID 3455259
3-[azepan-1-yl-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 3455259) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is 3-[azepan-1-yl-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[azepan-1-yl-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3455259 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 3-[azepan-1-yl-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(C(c3nnnn3Cc3ccc(F)cc3)N3CCCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C25H27FN6O/c1-17-6-9-19-15-21(25(33)27-22(19)14-17)23(31-12-4-2-3-5-13-31)24-28-29-30-32(24)16-18-7-10-20(26)11-8-18/h6-11,14-15,23H,2-5,12-13,16H2,1H3,(H,27,33) |
| InChIKey | GZINXDLVQPRABK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |