C18H38S — CID 3455375
2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-thiol (PubChem CID 3455375) has the molecular formula C18H38S and a molecular weight of 286.57 g/mol. Its IUPAC name is 2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-thiol.
| Compound Name | 2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-thiol |
|---|---|
| PubChem CID | 3455375 |
| Molecular Formula | C18H38S |
| Molecular Weight | 286.57 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | 2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-thiol |
| SMILES | CC(CCC(CS)C(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H38S/c1-14(11-17(3,4)5)9-10-16(13-19)15(2)12-18(6,7)8/h14-16,19H,9-13H2,1-8H3 |
| InChIKey | WAWMCFGBWCOOPL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|