About 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid
5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid (PubChem CID 3455633) has the molecular formula C21H21ClFNO4
and a molecular weight of 405.85 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid |
| PubChem CID | 3455633 |
| Molecular Formula | C21H21ClFNO4 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid |
| SMILES | CCCC1=NOC(C(=O)O)(C(OCc2ccc(F)cc2)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C21H21ClFNO4/c1-2-3-18-12-21(20(25)26,28-24-18)19(15-6-8-16(22)9-7-15)27-13-14-4-10-17(23)11-5-14/h4-11,19H,2-3,12-13H2,1H3,(H,25,26) |
| InChIKey | QWSQDEQYIUHDEM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid?
The IUPAC name of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid (CID 3455633) is 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid.
What is the SMILES notation for 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid?
The canonical SMILES for 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid is CCCC1=NOC(C(=O)O)(C(OCc2ccc(F)cc2)c2ccc(Cl)cc2)C1.
What is the InChIKey of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid?
The InChIKey is QWSQDEQYIUHDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClFNO4/c1-2-3-18-12-21(20(25)26,28-24-18)19(15-6-8-16(22)9-7-15)27-13-14-4-10-17(23)11-5-14/h4-11,19H,2-3,12-13H2,1H3,(H,25,26).
What are the key properties of 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid?
5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid has a molecular weight of 405.85 g/mol, XLogP of 5.14, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chlorophenyl)-[(4-fluorophenyl)methoxy]methyl]-3-propyl-4H-1,2-oxazole-5-carboxylic acid is sourced from PubChem (CID 3455633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).