C12H22Si — CID 3456028
trimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 3456028) has the molecular formula C12H22Si and a molecular weight of 194.39 g/mol. Its IUPAC name is trimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | trimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 3456028 |
| Molecular Formula | C12H22Si |
| Molecular Weight | 194.39 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | trimethyl-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C12H22Si/c1-8-9(2)11(4)12(10(8)3)13(5,6)7/h12H,1-7H3 |
| InChIKey | VEUUNIUMKJTBJB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|