About 3-methylpent-4-enoic acid
3-methylpent-4-enoic acid (PubChem CID 3456032) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 3-methylpent-4-enoic acid.
Molecular Properties
| Compound Name | 3-methylpent-4-enoic acid |
| PubChem CID | 3456032 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 3-methylpent-4-enoic acid |
| SMILES | C=CC(C)CC(=O)O |
| InChI | InChI=1S/C6H10O2/c1-3-5(2)4-6(7)8/h3,5H,1,4H2,2H3,(H,7,8) |
| InChIKey | QNPZXLANENFTFK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpent-4-enoic acid?
The IUPAC name of 3-methylpent-4-enoic acid (CID 3456032) is 3-methylpent-4-enoic acid.
What is the SMILES notation for 3-methylpent-4-enoic acid?
The canonical SMILES for 3-methylpent-4-enoic acid is C=CC(C)CC(=O)O.
What is the InChIKey of 3-methylpent-4-enoic acid?
The InChIKey is QNPZXLANENFTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-3-5(2)4-6(7)8/h3,5H,1,4H2,2H3,(H,7,8).
What are the key properties of 3-methylpent-4-enoic acid?
3-methylpent-4-enoic acid has a molecular weight of 114.14 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpent-4-enoic acid is sourced from PubChem (CID 3456032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).