About 1,1-dibutyl-3-(3,4-dimethylphenyl)urea
1,1-dibutyl-3-(3,4-dimethylphenyl)urea (PubChem CID 3456501) has the molecular formula C17H28N2O
and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,1-dibutyl-3-(3,4-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1,1-dibutyl-3-(3,4-dimethylphenyl)urea |
| PubChem CID | 3456501 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1,1-dibutyl-3-(3,4-dimethylphenyl)urea |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H28N2O/c1-5-7-11-19(12-8-6-2)17(20)18-16-10-9-14(3)15(4)13-16/h9-10,13H,5-8,11-12H2,1-4H3,(H,18,20) |
| InChIKey | AIYSSRSKDGVHAF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1-dibutyl-3-(3,4-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutyl-3-(3,4-dimethylphenyl)urea?
The IUPAC name of 1,1-dibutyl-3-(3,4-dimethylphenyl)urea (CID 3456501) is 1,1-dibutyl-3-(3,4-dimethylphenyl)urea.
What is the SMILES notation for 1,1-dibutyl-3-(3,4-dimethylphenyl)urea?
The canonical SMILES for 1,1-dibutyl-3-(3,4-dimethylphenyl)urea is CCCCN(CCCC)C(=O)Nc1ccc(C)c(C)c1.
What is the InChIKey of 1,1-dibutyl-3-(3,4-dimethylphenyl)urea?
The InChIKey is AIYSSRSKDGVHAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O/c1-5-7-11-19(12-8-6-2)17(20)18-16-10-9-14(3)15(4)13-16/h9-10,13H,5-8,11-12H2,1-4H3,(H,18,20).
What are the key properties of 1,1-dibutyl-3-(3,4-dimethylphenyl)urea?
1,1-dibutyl-3-(3,4-dimethylphenyl)urea has a molecular weight of 276.42 g/mol, XLogP of 4.74, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutyl-3-(3,4-dimethylphenyl)urea is sourced from PubChem (CID 3456501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).